Nama produk |
DL-2-(4-chlorophenyl)propan-oic acid |
Sinonim |
4-chloromethyl phenylacetic acid; 2-(4-chlorophenyl)propanoic acid; [4-(chloromethyl)phenyl]acetic acid; 2-(4-chlorophenyl)propionic acid |
MF |
C9H9ClO2 |
Berat Molekul |
184.6196 |
InChI |
InChI=1/C9H9ClO2/c10-6-8-3-1-7(2-4-8)5-9(11)12/h1-4H,5-6H2,(H,11,12) |
CAS NO |
938-95-4 |
EINECS |
213-351-1 |
Struktur Molekul |
|
Kepadatan |
1.277g/cm3 |
Titik didih |
332.2°C at 760 mmHg |
Indeks bias |
1.565 |
Titik nyala |
154.7°C |
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|