produktnavn |
DL-2-(4-chlorophenyl)propan-oic acid |
Synonymer |
4-chloromethyl phenylacetic acid; 2-(4-chlorophenyl)propanoic acid; [4-(chloromethyl)phenyl]acetic acid; 2-(4-chlorophenyl)propionic acid |
Molekylær Formel |
C9H9ClO2 |
Molekylvekt |
184.6196 |
InChI |
InChI=1/C9H9ClO2/c10-6-8-3-1-7(2-4-8)5-9(11)12/h1-4H,5-6H2,(H,11,12) |
CAS-nummer |
938-95-4 |
EINECS |
213-351-1 |
Molecular Structure |
|
Tetthet |
1.277g/cm3 |
Kokepunkt |
332.2°C at 760 mmHg |
Brytningsindeks |
1.565 |
Flammepunktet |
154.7°C |
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|