Nome del prodotto |
ethyl 4-(butylamino)benzoate |
Sinonimi |
Ethyl 4-(n-butylamino)benzoate; 4-(n-Butylamino)benzoic acid ethyl ester; Ethyl-4-n-butylamino-benzoate |
Formula molecolare |
C13H19NO2 |
Peso Molecolare |
221.2955 |
InChI |
InChI=1/C13H19NO2/c1-3-5-10-14-12-8-6-11(7-9-12)13(15)16-4-2/h6-9,14H,3-5,10H2,1-2H3 |
Numero CAS |
94-32-6 |
EINECS |
202-322-9 |
Struttura molecolare |
|
Densità |
1.039g/cm3 |
Punto di fusione |
68-70℃ |
Punto di ebollizione |
338.4°C at 760 mmHg |
Indice di rifrazione |
1.534 |
Punto d'infiammabilità |
158.4°C |
Sicurezza Descrizione |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|