상품명칭 |
ethyl 4-(butylamino)benzoate |
별명 |
Ethyl 4-(n-butylamino)benzoate; 4-(n-Butylamino)benzoic acid ethyl ester; Ethyl-4-n-butylamino-benzoate |
분자식 |
C13H19NO2 |
분자량 |
221.2955 |
InChI |
InChI=1/C13H19NO2/c1-3-5-10-14-12-8-6-11(7-9-12)13(15)16-4-2/h6-9,14H,3-5,10H2,1-2H3 |
cas번호 |
94-32-6 |
EC번호 |
202-322-9 |
분자 구조 |
|
밀도 |
1.039g/cm3 |
녹는 점 |
68-70℃ |
비등점 |
338.4°C at 760 mmHg |
굴절 지수 |
1.534 |
인화점 |
158.4°C |
보안 규칙 |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|