Nazwa produktu: |
ethyl 4-(butylamino)benzoate |
Synonimy |
Ethyl 4-(n-butylamino)benzoate; 4-(n-Butylamino)benzoic acid ethyl ester; Ethyl-4-n-butylamino-benzoate |
MF |
C13H19NO2 |
Masie czÄ…steczkowej |
221.2955 |
InChI |
InChI=1/C13H19NO2/c1-3-5-10-14-12-8-6-11(7-9-12)13(15)16-4-2/h6-9,14H,3-5,10H2,1-2H3 |
Nr CAS |
94-32-6 |
EINECS |
202-322-9 |
Struktury molekularnej |
|
Gęstość |
1.039g/cm3 |
Temperatura topnienia |
68-70℃ |
Temperatura wrzenia |
338.4°C at 760 mmHg |
Współczynnik załamania |
1.534 |
Temperatura zapłonu |
158.4°C |
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|