Ονομασία του προϊόντος |
2-Hydroxythioanisole |
Συνώνυμα |
2-(Methylmercapto)phenol; 2-(Methylthio)phenol; 2-(Methylthio)-phenol; 2-(methylsulfanyl)phenol; 2-Methylthio phenol; O-(methylthio)phenol |
MF |
C7H8OS |
Μοριακό βάρος |
140.2028 |
InChI |
InChI=1/C7H8OS/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3 |
CAS ΟΧΙ |
1073-29-6 |
EINECS |
214-027-2 |
Μοριακή δομή |
|
Πυκνότητα |
1.19g/cm3 |
Σημείο βρασμού |
206.1°C at 760 mmHg |
Δείκτης διάθλασης |
1.613 |
Σημείο ανάφλεξης |
108°C |
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|