उत्पाद का नाम |
2-Hydroxythioanisole |
समानार्थी |
2-(Methylmercapto)phenol; 2-(Methylthio)phenol; 2-(Methylthio)-phenol; 2-(methylsulfanyl)phenol; 2-Methylthio phenol; O-(methylthio)phenol |
आणविक फार्मूला |
C7H8OS |
आण्विक वजन |
140.2028 |
InChI |
InChI=1/C7H8OS/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3 |
कैस रजिस्टी संख्या |
1073-29-6 |
EINECS |
214-027-2 |
आणविक संरचना |
|
घनत्व |
1.19g/cm3 |
उबलने का समय |
206.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.613 |
फ्लैश प्वाइंट |
108°C |
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|