שם המוצר |
2-Hydroxythioanisole |
נרדפות |
2-(Methylmercapto)phenol; 2-(Methylthio)phenol; 2-(Methylthio)-phenol; 2-(methylsulfanyl)phenol; 2-Methylthio phenol; O-(methylthio)phenol |
מולקולרית פורמולה |
C7H8OS |
משקל מולקולרי |
140.2028 |
InChI |
InChI=1/C7H8OS/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3 |
מספר CAS |
1073-29-6 |
EINECS |
214-027-2 |
מבנה מולקולרי |
|
צפיפות |
1.19g/cm3 |
נקודת רתיחה |
206.1°C at 760 mmHg |
משקל סגולי |
1.613 |
נקודת הבזק |
108°C |
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|