Nama produk |
2-Hydroxythioanisole |
Sinonim |
2-(Methylmercapto)phenol; 2-(Methylthio)phenol; 2-(Methylthio)-phenol; 2-(methylsulfanyl)phenol; 2-Methylthio phenol; O-(methylthio)phenol |
MF |
C7H8OS |
Berat Molekul |
140.2028 |
InChI |
InChI=1/C7H8OS/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3 |
CAS NO |
1073-29-6 |
EINECS |
214-027-2 |
Struktur Molekul |
|
Kepadatan |
1.19g/cm3 |
Titik didih |
206.1°C at 760 mmHg |
Indeks bias |
1.613 |
Titik nyala |
108°C |
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|