Ονομασία του προϊόντος |
2,4,6-Trifluorobenzeneboronic acid |
Συνώνυμα |
2,4,6-Trifluorophenylboronicacid; 2,4,6-Trifluorophenylboronic acid |
MF |
C6H4BF3O2 |
Μοριακό βάρος |
175.901 |
InChI |
InChI=1/C6H4BF3O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2,11-12H |
CAS ΟΧΙ |
182482-25-3 |
Μοριακή δομή |
|
Πυκνότητα |
1.44g/cm3 |
Σημείο τήξης |
228-235℃ |
Σημείο βρασμού |
266°C at 760 mmHg |
Δείκτης διάθλασης |
1.465 |
Σημείο ανάφλεξης |
114.6°C |
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|