نام محصول |
2,4,6-Trifluorobenzeneboronic acid |
مترادف |
2,4,6-Trifluorophenylboronicacid; 2,4,6-Trifluorophenylboronic acid |
میدان مغناطیسی |
C6H4BF3O2 |
وزن مولکولی |
175.901 |
InChI |
InChI=1/C6H4BF3O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2,11-12H |
شماره سیایاس |
182482-25-3 |
ساختار مولکولی |
|
تراکم |
1.44g/cm3 |
نقطه ذوب |
228-235℃ |
نقطه غلیان |
266°C at 760 mmHg |
ضریب شکست |
1.465 |
نقطه اشتعال |
114.6°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|