Naam product |
2,4,6-Trifluorobenzeneboronic acid |
Synoniemen |
2,4,6-Trifluorophenylboronicacid; 2,4,6-Trifluorophenylboronic acid |
MF |
C6H4BF3O2 |
Molecuulgewicht |
175.901 |
InChI |
InChI=1/C6H4BF3O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2,11-12H |
CAS-nummer |
182482-25-3 |
Moleculaire Structuur |
|
Dichtheid |
1.44g/cm3 |
Smeltpunt |
228-235℃ |
Kookpunt |
266°C at 760 mmHg |
Brekingsindex |
1.465 |
Vlampunt |
114.6°C |
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|