Nama produk |
2,4,6-Trifluorobenzeneboronic acid |
Sinonim |
2,4,6-Trifluorophenylboronicacid; 2,4,6-Trifluorophenylboronic acid |
MF |
C6H4BF3O2 |
Berat Molekul |
175.901 |
InChI |
InChI=1/C6H4BF3O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2,11-12H |
CAS NO |
182482-25-3 |
Struktur Molekul |
|
Kepadatan |
1.44g/cm3 |
Titik lebur |
228-235℃ |
Titik didih |
266°C at 760 mmHg |
Indeks bias |
1.465 |
Titik nyala |
114.6°C |
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|