Ονομασία του προϊόντος |
3-Bromothiophene-2-carbonitrile |
Συνώνυμα |
3-Bromo-2-cyanothiophene |
MF |
C5H2BrNS |
Μοριακό βάρος |
188.0451 |
InChI |
InChI=1/C5H2BrNS/c6-4-1-2-8-5(4)3-7/h1-2H |
CAS ΟΧΙ |
18791-98-5 |
Μοριακή δομή |
|
Πυκνότητα |
1.82g/cm3 |
Σημείο βρασμού |
286.8°C at 760 mmHg |
Δείκτης διάθλασης |
1.641 |
Σημείο ανάφλεξης |
127.3°C |
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Περιγραφή της ασφάλειας |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|