Nama produk |
3-Bromothiophene-2-carbonitrile |
Sinonim |
3-Bromo-2-cyanothiophene |
MF |
C5H2BrNS |
Berat Molekul |
188.0451 |
InChI |
InChI=1/C5H2BrNS/c6-4-1-2-8-5(4)3-7/h1-2H |
CAS NO |
18791-98-5 |
Struktur Molekul |
|
Kepadatan |
1.82g/cm3 |
Titik didih |
286.8°C at 760 mmHg |
Indeks bias |
1.641 |
Titik nyala |
127.3°C |
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|