produktnavn |
3-Bromothiophene-2-carbonitrile |
Synonymer |
3-Bromo-2-cyanothiophene |
Molekylær Formel |
C5H2BrNS |
Molekylvekt |
188.0451 |
InChI |
InChI=1/C5H2BrNS/c6-4-1-2-8-5(4)3-7/h1-2H |
CAS-nummer |
18791-98-5 |
Molecular Structure |
|
Tetthet |
1.82g/cm3 |
Kokepunkt |
286.8°C at 760 mmHg |
Brytningsindeks |
1.641 |
Flammepunktet |
127.3°C |
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|