Nazwa produktu: |
3-Bromothiophene-2-carbonitrile |
Synonimy |
3-Bromo-2-cyanothiophene |
MF |
C5H2BrNS |
Masie cząsteczkowej |
188.0451 |
InChI |
InChI=1/C5H2BrNS/c6-4-1-2-8-5(4)3-7/h1-2H |
Nr CAS |
18791-98-5 |
Struktury molekularnej |
|
Gęstość |
1.82g/cm3 |
Temperatura wrzenia |
286.8°C at 760 mmHg |
Współczynnik załamania |
1.641 |
Temperatura zapłonu |
127.3°C |
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|