6-Aminochrysene

Ονομασία του προϊόντος	6-Aminochrysene
Συνώνυμα	6-Chrysenamine; chrysen-6-ylamine; chrysen-6-amine
MF	C₁₈H₁₃N
Μοριακό βάρος	243.3025
InChI	InChI=1/C18H13N/c19-18-11-17-13-6-2-1-5-12(13)9-10-15(17)14-7-3-4-8-16(14)18/h1-11H,19H2
CAS ΟΧΙ	2642-98-0
EINECS	220-149-7
Μοριακή δομή
Πυκνότητα	1.253g/cm³
Σημείο τήξης	206-211℃
Σημείο βρασμού	501.2°C at 760 mmHg
Δείκτης διάθλασης	1.813
Σημείο ανάφλεξης	286.9°C
Σύμβολα επικινδυνότητας	Xn:Harmful;
Περιγραφή της ασφάλειας	S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;