שם המוצר |
6-Aminochrysene |
נרדפות |
6-Chrysenamine; chrysen-6-ylamine; chrysen-6-amine |
מולקולרית פורמולה |
C18H13N |
משקל מולקולרי |
243.3025 |
InChI |
InChI=1/C18H13N/c19-18-11-17-13-6-2-1-5-12(13)9-10-15(17)14-7-3-4-8-16(14)18/h1-11H,19H2 |
מספר CAS |
2642-98-0 |
EINECS |
220-149-7 |
מבנה מולקולרי |
|
צפיפות |
1.253g/cm3 |
נקודת ההתוך |
206-211℃ |
נקודת רתיחה |
501.2°C at 760 mmHg |
משקל סגולי |
1.813 |
נקודת הבזק |
286.9°C |
Hazard סימנים |
Xn:Harmful;
|
בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|