Nazwa produktu: |
6-Aminochrysene |
Synonimy |
6-Chrysenamine; chrysen-6-ylamine; chrysen-6-amine |
MF |
C18H13N |
Masie cząsteczkowej |
243.3025 |
InChI |
InChI=1/C18H13N/c19-18-11-17-13-6-2-1-5-12(13)9-10-15(17)14-7-3-4-8-16(14)18/h1-11H,19H2 |
Nr CAS |
2642-98-0 |
EINECS |
220-149-7 |
Struktury molekularnej |
|
Gęstość |
1.253g/cm3 |
Temperatura topnienia |
206-211℃ |
Temperatura wrzenia |
501.2°C at 760 mmHg |
Współczynnik załamania |
1.813 |
Temperatura zapłonu |
286.9°C |
Symbole zagrożenia |
Xn:Harmful;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|