6-Aminochrysene

उत्पाद का नाम	6-Aminochrysene
समानार्थी	6-Chrysenamine; chrysen-6-ylamine; chrysen-6-amine
आणविक फार्मूला	C₁₈H₁₃N
आण्विक वजन	243.3025
InChI	InChI=1/C18H13N/c19-18-11-17-13-6-2-1-5-12(13)9-10-15(17)14-7-3-4-8-16(14)18/h1-11H,19H2
कैस रजिस्टी संख्या	2642-98-0
EINECS	220-149-7
आणविक संरचना
घनत्व	1.253g/cm³
गलनांक	206-211℃
उबलने का समय	501.2°C at 760 mmHg
अपवर्तक सूचकांक	1.813
फ्लैश प्वाइंट	286.9°C
खतरा प्रतीक	Xn:Harmful;
सुरक्षा विवरण	S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;