Benzyl tiglate

termék neve	Benzyl tiglate
Szinonimák	Tiglic acid benzyl ester; Benzyl trans-2,3-dimethylacrylate~Benzyl (E)-2-methyl-2-butenoate~Tiglic acid benzyl ester; benzyl 2-methylbut-2-enoate; benzyl (2E)-2-methylbut-2-enoate
MF	C₁₂H₁₄O₂
Molekulatömeg	190.2384
InChI	InChI=1/C12H14O2/c1-3-10(2)12(13)14-9-11-7-5-4-6-8-11/h3-8H,9H2,1-2H3/b10-3+
CAS-szám	37526-88-8
EINECS	253-544-8
Molekuláris szerkezete
Sűrűség	1.027g/cm³
Forráspont	267.7°C at 760 mmHg
Törésmutató	1.516
Gyulladáspont	135.9°C
Kockázatot kódok	R36/38:Irritating to eyes and skin.;
Biztonsági Leírás	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;