Nama produk |
Benzyl tiglate |
Sinonim |
Tiglic acid benzyl ester; Benzyl trans-2,3-dimethylacrylate~Benzyl (E)-2-methyl-2-butenoate~Tiglic acid benzyl ester; benzyl 2-methylbut-2-enoate; benzyl (2E)-2-methylbut-2-enoate |
MF |
C12H14O2 |
Berat Molekul |
190.2384 |
InChI |
InChI=1/C12H14O2/c1-3-10(2)12(13)14-9-11-7-5-4-6-8-11/h3-8H,9H2,1-2H3/b10-3+ |
CAS NO |
37526-88-8 |
EINECS |
253-544-8 |
Struktur Molekul |
|
Kepadatan |
1.027g/cm3 |
Titik didih |
267.7°C at 760 mmHg |
Indeks bias |
1.516 |
Titik nyala |
135.9°C |
Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|