Benzyl tiglate

نام محصول	Benzyl tiglate
مترادف	Tiglic acid benzyl ester; Benzyl trans-2,3-dimethylacrylate~Benzyl (E)-2-methyl-2-butenoate~Tiglic acid benzyl ester; benzyl 2-methylbut-2-enoate; benzyl (2E)-2-methylbut-2-enoate
میدان مغناطیسی	C₁₂H₁₄O₂
وزن مولکولی	190.2384
InChI	InChI=1/C12H14O2/c1-3-10(2)12(13)14-9-11-7-5-4-6-8-11/h3-8H,9H2,1-2H3/b10-3+
شماره سیایاس	37526-88-8
تعداد کمیسیون اروپایی	253-544-8
ساختار مولکولی
تراکم	1.027g/cm³
نقطه غلیان	267.7°C at 760 mmHg
ضریب شکست	1.516
نقطه اشتعال	135.9°C
کدهای خطر	R36/38:Irritating to eyes and skin.;
توضیحات ایمنی	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;