نام محصول |
Benzyl tiglate |
مترادف |
Tiglic acid benzyl ester; Benzyl trans-2,3-dimethylacrylate~Benzyl (E)-2-methyl-2-butenoate~Tiglic acid benzyl ester; benzyl 2-methylbut-2-enoate; benzyl (2E)-2-methylbut-2-enoate |
میدان مغناطیسی |
C12H14O2 |
وزن مولکولی |
190.2384 |
InChI |
InChI=1/C12H14O2/c1-3-10(2)12(13)14-9-11-7-5-4-6-8-11/h3-8H,9H2,1-2H3/b10-3+ |
شماره سیایاس |
37526-88-8 |
تعداد کمیسیون اروپایی |
253-544-8 |
ساختار مولکولی |
|
تراکم |
1.027g/cm3 |
نقطه غلیان |
267.7°C at 760 mmHg |
ضریب شکست |
1.516 |
نقطه اشتعال |
135.9°C |
کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|