Benzyl tiglate

اسم المنتج	Benzyl tiglate
الاسم المستعار	Tiglic acid benzyl ester; Benzyl trans-2,3-dimethylacrylate~Benzyl (E)-2-methyl-2-butenoate~Tiglic acid benzyl ester; benzyl 2-methylbut-2-enoate; benzyl (2E)-2-methylbut-2-enoate
الصيغة الجزيئية	C₁₂H₁₄O₂
الوزن الجزيئي الغرامي	190.2384
InChI	InChI=1/C12H14O2/c1-3-10(2)12(13)14-9-11-7-5-4-6-8-11/h3-8H,9H2,1-2H3/b10-3+
إستراتيجية المساعدة القطرية	37526-88-8
المفوضية الأوروبية رقم	253-544-8
بنية جزيئية
كثافة	1.027g/cm³
نقطة الغليان	267.7°C at 760 mmHg
معامل الإنكسار	1.516
نقطة الوميض	135.9°C
خطر المصطلحات	R36/38:Irritating to eyes and skin.;
شروط الأمن	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;