نام محصول |
Acetoacetic Acid |
مترادف |
3-Oxobutanoic acid |
میدان مغناطیسی |
C4H6O3 |
وزن مولکولی |
102.0886 |
InChI |
InChI=1/C4H6O3/c1-3(5)2-4(6)7/h2H2,1H3,(H,6,7) |
شماره سیایاس |
541-50-4 |
ساختار مولکولی |
|
تراکم |
1.182g/cm3 |
نقطه غلیان |
237.7°C at 760 mmHg |
ضریب شکست |
1.427 |
نقطه اشتعال |
111.8°C |
کدهای خطر |
R36/37:Irritating to eyes and respiratory system.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|