상품명칭 |
Acetoacetic Acid |
별명 |
3-Oxobutanoic acid |
분자식 |
C4H6O3 |
분자량 |
102.0886 |
InChI |
InChI=1/C4H6O3/c1-3(5)2-4(6)7/h2H2,1H3,(H,6,7) |
cas번호 |
541-50-4 |
분자 구조 |
|
밀도 |
1.182g/cm3 |
비등점 |
237.7°C at 760 mmHg |
굴절 지수 |
1.427 |
인화점 |
111.8°C |
리스크 규칙 |
R36/37:Irritating to eyes and respiratory system.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|