اسم المنتج |
Acetoacetic Acid |
الاسم المستعار |
3-Oxobutanoic acid |
الصيغة الجزيئية |
C4H6O3 |
الوزن الجزيئي الغرامي |
102.0886 |
InChI |
InChI=1/C4H6O3/c1-3(5)2-4(6)7/h2H2,1H3,(H,6,7) |
إستراتيجية المساعدة القطرية |
541-50-4 |
بنية جزيئية |
|
كثافة |
1.182g/cm3 |
نقطة الغليان |
237.7°C at 760 mmHg |
معامل الإنكسار |
1.427 |
نقطة الوميض |
111.8°C |
خطر المصطلحات |
R36/37:Irritating to eyes and respiratory system.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|