Nama produk |
Acetoacetic Acid |
Sinonim |
3-Oxobutanoic acid |
MF |
C4H6O3 |
Berat Molekul |
102.0886 |
InChI |
InChI=1/C4H6O3/c1-3(5)2-4(6)7/h2H2,1H3,(H,6,7) |
CAS NO |
541-50-4 |
Struktur Molekul |
|
Kepadatan |
1.182g/cm3 |
Titik didih |
237.7°C at 760 mmHg |
Indeks bias |
1.427 |
Titik nyala |
111.8°C |
Kod Risiko |
R36/37:Irritating to eyes and respiratory system.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|