product Name |
3-Methylthiophene-2-carbonitrile |
Synonyms |
2-Cyano-3-methylthiophene |
Molecular Formula |
C6H5NS |
Molecular Weight |
123.1756 |
InChI |
InChI=1/C6H5NS/c1-5-2-3-8-6(5)4-7/h2-3H,1H3 |
CAS Registry Number |
55406-13-8 |
Molecular Structure |
|
Density |
1.16g/cm3 |
Boiling point |
212.7°C at 760 mmHg |
Refractive index |
1.556 |
Flash point |
82.4°C |
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Description |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|