Naam product |
3-Methylthiophene-2-carbonitrile |
Synoniemen |
2-Cyano-3-methylthiophene |
MF |
C6H5NS |
Molecuulgewicht |
123.1756 |
InChI |
InChI=1/C6H5NS/c1-5-2-3-8-6(5)4-7/h2-3H,1H3 |
CAS-nummer |
55406-13-8 |
Moleculaire Structuur |
|
Dichtheid |
1.16g/cm3 |
Kookpunt |
212.7°C at 760 mmHg |
Brekingsindex |
1.556 |
Vlampunt |
82.4°C |
Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Veiligheid Omschrijving |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|