상품명칭 |
3-Methylthiophene-2-carbonitrile |
별명 |
2-Cyano-3-methylthiophene |
분자식 |
C6H5NS |
분자량 |
123.1756 |
InChI |
InChI=1/C6H5NS/c1-5-2-3-8-6(5)4-7/h2-3H,1H3 |
cas번호 |
55406-13-8 |
분자 구조 |
|
밀도 |
1.16g/cm3 |
비등점 |
212.7°C at 760 mmHg |
굴절 지수 |
1.556 |
인화점 |
82.4°C |
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|