Ürün Adı |
3-Methylthiophene-2-carbonitrile |
Eş anlamlı |
2-Cyano-3-methylthiophene |
Moleküler Formülü |
C6H5NS |
Molekül Ağırlığı |
123.1756 |
InChI |
InChI=1/C6H5NS/c1-5-2-3-8-6(5)4-7/h2-3H,1H3 |
CAS kayıt numarası |
55406-13-8 |
Moleküler Yapısı |
|
YoÄŸunluk |
1.16g/cm3 |
Kaynama noktası |
212.7°C at 760 mmHg |
Kırılma indisi |
1.556 |
Alevlenme noktası |
82.4°C |
Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Güvenlik Açıklaması |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|