نام محصول |
Methyl N-ethylcarbamate |
مترادف |
N-Ethylcarbamic acid methyl ester; methyl ethylcarbamate |
میدان مغناطیسی |
C4H9NO2 |
وزن مولکولی |
103.1198 |
InChI |
InChI=1/C4H9NO2/c1-3-5-4(6)7-2/h3H2,1-2H3,(H,5,6) |
شماره سیایاس |
6135-31-5 |
ساختار مولکولی |
|
تراکم |
0.964g/cm3 |
نقطه غلیان |
172°C at 760 mmHg |
ضریب شکست |
1.4 |
نقطه اشتعال |
57.8°C |
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|