Nome del prodotto |
Methyl N-ethylcarbamate |
Sinonimi |
N-Ethylcarbamic acid methyl ester; methyl ethylcarbamate |
Formula molecolare |
C4H9NO2 |
Peso Molecolare |
103.1198 |
InChI |
InChI=1/C4H9NO2/c1-3-5-4(6)7-2/h3H2,1-2H3,(H,5,6) |
Numero CAS |
6135-31-5 |
Struttura molecolare |
|
Densità |
0.964g/cm3 |
Punto di ebollizione |
172°C at 760 mmHg |
Indice di rifrazione |
1.4 |
Punto d'infiammabilità |
57.8°C |
Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sicurezza Descrizione |
S36/37:Wear suitable protective clothing and gloves.;
|
|