Nazwa produktu: |
Methyl N-ethylcarbamate |
Synonimy |
N-Ethylcarbamic acid methyl ester; methyl ethylcarbamate |
MF |
C4H9NO2 |
Masie cząsteczkowej |
103.1198 |
InChI |
InChI=1/C4H9NO2/c1-3-5-4(6)7-2/h3H2,1-2H3,(H,5,6) |
Nr CAS |
6135-31-5 |
Struktury molekularnej |
|
Gęstość |
0.964g/cm3 |
Temperatura wrzenia |
172°C at 760 mmHg |
Współczynnik załamania |
1.4 |
Temperatura zapłonu |
57.8°C |
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|