상품명칭 |
Methyl N-ethylcarbamate |
별명 |
N-Ethylcarbamic acid methyl ester; methyl ethylcarbamate |
분자식 |
C4H9NO2 |
분자량 |
103.1198 |
InChI |
InChI=1/C4H9NO2/c1-3-5-4(6)7-2/h3H2,1-2H3,(H,5,6) |
cas번호 |
6135-31-5 |
분자 구조 |
|
밀도 |
0.964g/cm3 |
비등점 |
172°C at 760 mmHg |
굴절 지수 |
1.4 |
인화점 |
57.8°C |
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|