Produkt-Name |
1-Bromo-2,3,5-trichlorobenzene |
Synonyme |
2,3,5-Trichlorobromobenzene |
Molekulare Formel |
C6H2BrCl3 |
Molecular Weight |
260.3431 |
InChI |
InChI=1/C6H2BrCl3/c7-4-1-3(8)2-5(9)6(4)10/h1-2H |
CAS Registry Number |
81067-38-1 |
Molecular Structure |
|
Dichte |
1.84g/cm3 |
Schmelzpunkt |
58-61℃ |
Siedepunkt |
270.8°C at 760 mmHg |
Brechungsindex |
1.603 |
Flammpunkt |
129.3°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|