نام محصول |
1-Bromo-2,3,5-trichlorobenzene |
مترادف |
2,3,5-Trichlorobromobenzene |
میدان مغناطیسی |
C6H2BrCl3 |
وزن مولکولی |
260.3431 |
InChI |
InChI=1/C6H2BrCl3/c7-4-1-3(8)2-5(9)6(4)10/h1-2H |
شماره سیایاس |
81067-38-1 |
ساختار مولکولی |
|
تراکم |
1.84g/cm3 |
نقطه ذوب |
58-61℃ |
نقطه غلیان |
270.8°C at 760 mmHg |
ضریب شکست |
1.603 |
نقطه اشتعال |
129.3°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|