Ürün Adı |
1-Bromo-2,3,5-trichlorobenzene |
Eş anlamlı |
2,3,5-Trichlorobromobenzene |
Moleküler Formülü |
C6H2BrCl3 |
Molekül Ağırlığı |
260.3431 |
InChI |
InChI=1/C6H2BrCl3/c7-4-1-3(8)2-5(9)6(4)10/h1-2H |
CAS kayıt numarası |
81067-38-1 |
Moleküler Yapısı |
|
Yoğunluk |
1.84g/cm3 |
Ergime noktası |
58-61℃ |
Kaynama noktası |
270.8°C at 760 mmHg |
Kırılma indisi |
1.603 |
Alevlenme noktası |
129.3°C |
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|