produktnavn |
1-Bromo-2,3,5-trichlorobenzene |
Synonymer |
2,3,5-Trichlorobromobenzene |
Molekylær Formel |
C6H2BrCl3 |
Molekylvekt |
260.3431 |
InChI |
InChI=1/C6H2BrCl3/c7-4-1-3(8)2-5(9)6(4)10/h1-2H |
CAS-nummer |
81067-38-1 |
Molecular Structure |
|
Tetthet |
1.84g/cm3 |
Smeltepunkt |
58-61℃ |
Kokepunkt |
270.8°C at 760 mmHg |
Brytningsindeks |
1.603 |
Flammepunktet |
129.3°C |
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|