název výrobku |
2-Iodophenyl isothiocyanate |
Synonyma |
2-Iodoisothiocyanatobenzene; 1-iodo-2-isothiocyanatobenzene |
Molekulární vzorec |
C7H4INS |
Molekulová hmotnost |
261.0828 |
InChI |
InChI=1/C7H4INS/c8-6-3-1-2-4-7(6)9-5-10/h1-4H |
Registrační číslo CAS |
98041-44-2 |
Molekulární struktura |
|
Hustota |
1.76g/cm3 |
Bod tání |
36-39℃ |
Bod varu |
304.2°C at 760 mmHg |
Index lomu |
1.672 |
Bod vzplanutí |
137.8°C |
Riziko Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpečnostní Popis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|