उत्पाद का नाम |
2-Iodophenyl isothiocyanate |
समानार्थी |
2-Iodoisothiocyanatobenzene; 1-iodo-2-isothiocyanatobenzene |
आणविक फार्मूला |
C7H4INS |
आण्विक वजन |
261.0828 |
InChI |
InChI=1/C7H4INS/c8-6-3-1-2-4-7(6)9-5-10/h1-4H |
कैस रजिस्टी संख्या |
98041-44-2 |
आणविक संरचना |
|
घनत्व |
1.76g/cm3 |
गलनांक |
36-39℃ |
उबलने का समय |
304.2°C at 760 mmHg |
अपवर्तक सूचकांक |
1.672 |
फ्लैश प्वाइंट |
137.8°C |
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|