Ονομασία του προϊόντος |
2-Iodophenyl isothiocyanate |
Συνώνυμα |
2-Iodoisothiocyanatobenzene; 1-iodo-2-isothiocyanatobenzene |
MF |
C7H4INS |
Μοριακό βάρος |
261.0828 |
InChI |
InChI=1/C7H4INS/c8-6-3-1-2-4-7(6)9-5-10/h1-4H |
CAS ΟΧΙ |
98041-44-2 |
Μοριακή δομή |
|
Πυκνότητα |
1.76g/cm3 |
Σημείο τήξης |
36-39℃ |
Σημείο βρασμού |
304.2°C at 760 mmHg |
Δείκτης διάθλασης |
1.672 |
Σημείο ανάφλεξης |
137.8°C |
Κινδύνου Κώδικες |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|