Ürün Adı |
2-Iodophenyl isothiocyanate |
Eş anlamlı |
2-Iodoisothiocyanatobenzene; 1-iodo-2-isothiocyanatobenzene |
Moleküler Formülü |
C7H4INS |
Molekül Ağırlığı |
261.0828 |
InChI |
InChI=1/C7H4INS/c8-6-3-1-2-4-7(6)9-5-10/h1-4H |
CAS kayıt numarası |
98041-44-2 |
Moleküler Yapısı |
|
Yoğunluk |
1.76g/cm3 |
Ergime noktası |
36-39℃ |
Kaynama noktası |
304.2°C at 760 mmHg |
Kırılma indisi |
1.672 |
Alevlenme noktası |
137.8°C |
Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|