Produkt-Name |
2,3,6-trifluorobenzyl alcohol |
Molekulare Formel |
C7H5F3O |
Molecular Weight |
162.1092 |
InChI |
InChI=1/C7H5F3O/c8-5-1-2-6(9)7(10)4(5)3-11/h1-2,11H,3H2 |
CAS Registry Number |
114152-19-1 |
Molecular Structure |
|
Dichte |
1.398g/cm3 |
Schmelzpunkt |
43-45℃ |
Siedepunkt |
187°C at 760 mmHg |
Brechungsindex |
1.476 |
Flammpunkt |
80.8°C |
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|