2,3,6-trifluorobenzyl alcohol

उत्पाद का नाम	2,3,6-trifluorobenzyl alcohol
आणविक फार्मूला	C₇H₅F₃O
आण्विक वजन	162.1092
InChI	InChI=1/C7H5F3O/c8-5-1-2-6(9)7(10)4(5)3-11/h1-2,11H,3H2
कैस रजिस्टी संख्या	114152-19-1
आणविक संरचना
घनत्व	1.398g/cm³
गलनांक	43-45℃
उबलने का समय	187°C at 760 mmHg
अपवर्तक सूचकांक	1.476
फ्लैश प्वाइंट	80.8°C
खतरे के कोड	R36/38:Irritating to eyes and skin.;
सुरक्षा विवरण	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;