اسم المنتج |
2,3,6-trifluorobenzyl alcohol |
الصيغة الجزيئية |
C7H5F3O |
الوزن الجزيئي الغرامي |
162.1092 |
InChI |
InChI=1/C7H5F3O/c8-5-1-2-6(9)7(10)4(5)3-11/h1-2,11H,3H2 |
إستراتيجية المساعدة القطرية |
114152-19-1 |
بنية جزيئية |
|
كثافة |
1.398g/cm3 |
درجة الإنصهار |
43-45℃ |
نقطة الغليان |
187°C at 760 mmHg |
معامل الإنكسار |
1.476 |
نقطة الوميض |
80.8°C |
خطر المصطلحات |
R36/38:Irritating to eyes and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|