Nome del prodotto |
2,3,6-trifluorobenzyl alcohol |
Formula molecolare |
C7H5F3O |
Peso Molecolare |
162.1092 |
InChI |
InChI=1/C7H5F3O/c8-5-1-2-6(9)7(10)4(5)3-11/h1-2,11H,3H2 |
Numero CAS |
114152-19-1 |
Struttura molecolare |
|
Densità |
1.398g/cm3 |
Punto di fusione |
43-45℃ |
Punto di ebollizione |
187°C at 760 mmHg |
Indice di rifrazione |
1.476 |
Punto d'infiammabilità |
80.8°C |
Codici di Rischio |
R36/38:Irritating to eyes and skin.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|