상품명칭 |
2,3,6-trifluorobenzyl alcohol |
분자식 |
C7H5F3O |
분자량 |
162.1092 |
InChI |
InChI=1/C7H5F3O/c8-5-1-2-6(9)7(10)4(5)3-11/h1-2,11H,3H2 |
cas번호 |
114152-19-1 |
분자 구조 |
|
밀도 |
1.398g/cm3 |
녹는 점 |
43-45℃ |
비등점 |
187°C at 760 mmHg |
굴절 지수 |
1.476 |
인화점 |
80.8°C |
리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|